About acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol
acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol (PubChem CID 144917327) has the molecular formula C10H20N2OS
and a molecular weight of 216.35 g/mol. Its IUPAC name is acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol.
Molecular Properties
| Compound Name | acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol |
| PubChem CID | 144917327 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol |
| SMILES | C#C.CCCSN1CCNC[C@@H]1CO |
| InChI | InChI=1S/C8H18N2OS.C2H2/c1-2-5-12-10-4-3-9-6-8(10)7-11;1-2/h8-9,11H,2-7H2,1H3;1-2H/t8-;/m1./s1 |
| InChIKey | YLALIFGCZBMTOB-DDWIOCJRSA-N |
| XLogP | 0.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol?
The IUPAC name of acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol (CID 144917327) is acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol.
What is the SMILES notation for acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol?
The canonical SMILES for acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol is C#C.CCCSN1CCNC[C@@H]1CO.
What is the InChIKey of acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol?
The InChIKey is YLALIFGCZBMTOB-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H18N2OS.C2H2/c1-2-5-12-10-4-3-9-6-8(10)7-11;1-2/h8-9,11H,2-7H2,1H3;1-2H/t8-;/m1./s1.
What are the key properties of acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol?
acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol has a molecular weight of 216.35 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;[(2R)-1-propylsulfanylpiperazin-2-yl]methanol is sourced from PubChem (CID 144917327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).