C25H31NO2S — CID 138547628
2-phenoxy-N-phenyl-N-(1-thiaspiro[4.6]undecan-2-ylmethyl)acetamide (PubChem CID 138547628) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-phenoxy-N-phenyl-N-(1-thiaspiro[4.6]undecan-2-ylmethyl)acetamide.
| Compound Name | 2-phenoxy-N-phenyl-N-(1-thiaspiro[4.6]undecan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 138547628 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-phenoxy-N-phenyl-N-(1-thiaspiro[4.6]undecan-2-ylmethyl)acetamide |
| SMILES | O=C(COc1ccccc1)N(CC1CCC2(CCCCCC2)S1)c1ccccc1 |
| InChI | InChI=1S/C25H31NO2S/c27-24(20-28-22-13-7-4-8-14-22)26(21-11-5-3-6-12-21)19-23-15-18-25(29-23)16-9-1-2-10-17-25/h3-8,11-14,23H,1-2,9-10,15-20H2 |
| InChIKey | MZLRGNHQHOQXKU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |