C21H20N6O2S — CID 138548745
5-benzyl-N-[(2R,3R,4S,5S)-3,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 138548745) has the molecular formula C21H20N6O2S and a molecular weight of 420.50 g/mol. Its IUPAC name is 5-benzyl-N-[(2R,3R,4S,5S)-3,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-benzyl-N-[(2R,3R,4S,5S)-3,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 138548745 |
| Molecular Formula | C21H20N6O2S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-benzyl-N-[(2R,3R,4S,5S)-3,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | C[C@H]1[C@H]2c3nccnc3N(C)C(=O)[C@@H](NC(=O)c3nnc(Cc4ccccc4)s3)[C@@H]12 |
| InChI | InChI=1S/C21H20N6O2S/c1-11-14-15(11)17(21(29)27(2)18-16(14)22-8-9-23-18)24-19(28)20-26-25-13(30-20)10-12-6-4-3-5-7-12/h3-9,11,14-15,17H,10H2,1-2H3,(H,24,28)/t11-,14+,15-,17-/m0/s1 |
| InChIKey | FELUYEWAULSBRO-UTNFCUCBSA-N |
| XLogP | 2.04 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |