C15H19ClN2O2 — CID 138549954
tert-butyl N-(3-chloro-1-ethylindol-4-yl)carbamate (PubChem CID 138549954) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is tert-butyl N-(3-chloro-1-ethylindol-4-yl)carbamate.
| Compound Name | tert-butyl N-(3-chloro-1-ethylindol-4-yl)carbamate |
|---|---|
| PubChem CID | 138549954 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | tert-butyl N-(3-chloro-1-ethylindol-4-yl)carbamate |
| SMILES | CCn1cc(Cl)c2c(NC(=O)OC(C)(C)C)cccc21 |
| InChI | InChI=1S/C15H19ClN2O2/c1-5-18-9-10(16)13-11(7-6-8-12(13)18)17-14(19)20-15(2,3)4/h6-9H,5H2,1-4H3,(H,17,19) |
| InChIKey | OPJOAIKMYMDQLW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |