C18H27ClN2O3 — CID 142556614
tert-butyl N-[3-chloro-1-(2-methoxyethyl)indol-4-yl]carbamate;ethane (PubChem CID 142556614) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is tert-butyl N-[3-chloro-1-(2-methoxyethyl)indol-4-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[3-chloro-1-(2-methoxyethyl)indol-4-yl]carbamate;ethane |
|---|---|
| PubChem CID | 142556614 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl N-[3-chloro-1-(2-methoxyethyl)indol-4-yl]carbamate;ethane |
| SMILES | CC.COCCn1cc(Cl)c2c(NC(=O)OC(C)(C)C)cccc21 |
| InChI | InChI=1S/C16H21ClN2O3.C2H6/c1-16(2,3)22-15(20)18-12-6-5-7-13-14(12)11(17)10-19(13)8-9-21-4;1-2/h5-7,10H,8-9H2,1-4H3,(H,18,20);1-2H3 |
| InChIKey | JDQNBXPYONFRMJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |