About propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate
propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate (PubChem CID 138552208) has the molecular formula C17H25N5O2
and a molecular weight of 331.42 g/mol. Its IUPAC name is propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate.
Molecular Properties
| Compound Name | propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate |
| PubChem CID | 138552208 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate |
| SMILES | CC(C)OC(=O)C(N)(CC(C)(C)C)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C17H25N5O2/c1-11(2)24-15(23)17(18,10-16(3,4)5)13-8-6-12(7-9-13)14-19-21-22-20-14/h6-9,11H,10,18H2,1-5H3,(H,19,20,21,22) |
| InChIKey | IWTVJUBSPQERBD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate?
The IUPAC name of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate (CID 138552208) is propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate.
What is the SMILES notation for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate?
The canonical SMILES for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate is CC(C)OC(=O)C(N)(CC(C)(C)C)c1ccc(-c2nn[nH]n2)cc1.
What is the InChIKey of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate?
The InChIKey is IWTVJUBSPQERBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O2/c1-11(2)24-15(23)17(18,10-16(3,4)5)13-8-6-12(7-9-13)14-19-21-22-20-14/h6-9,11H,10,18H2,1-5H3,(H,19,20,21,22).
What are the key properties of propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate?
propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate has a molecular weight of 331.42 g/mol, XLogP of 2.41, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-amino-4,4-dimethyl-2-[4-(2H-tetrazol-5-yl)phenyl]pentanoate is sourced from PubChem (CID 138552208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).