C18H22N2O — CID 138552477
(2R)-2-amino-4,4-dimethyl-2-(4-pyridin-2-ylphenyl)pentanal (PubChem CID 138552477) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (2R)-2-amino-4,4-dimethyl-2-(4-pyridin-2-ylphenyl)pentanal.
| Compound Name | (2R)-2-amino-4,4-dimethyl-2-(4-pyridin-2-ylphenyl)pentanal |
|---|---|
| PubChem CID | 138552477 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (2R)-2-amino-4,4-dimethyl-2-(4-pyridin-2-ylphenyl)pentanal |
| SMILES | CC(C)(C)C[C@](N)(C=O)c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C18H22N2O/c1-17(2,3)12-18(19,13-21)15-9-7-14(8-10-15)16-6-4-5-11-20-16/h4-11,13H,12,19H2,1-3H3/t18-/m0/s1 |
| InChIKey | PEXSFJBDRHRZNM-SFHVURJKSA-N |
| XLogP | 3.54 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|