C13H21FN2O2 — CID 138552885
2-fluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate (PubChem CID 138552885) has the molecular formula C13H21FN2O2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-fluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | 2-fluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138552885 |
| Molecular Formula | C13H21FN2O2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-fluoroethyl (2S)-2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CN1CC=C([C@@H]2CCCN2C(=O)OCCF)CC1 |
| InChI | InChI=1S/C13H21FN2O2/c1-15-8-4-11(5-9-15)12-3-2-7-16(12)13(17)18-10-6-14/h4,12H,2-3,5-10H2,1H3/t12-/m0/s1 |
| InChIKey | CTJVJWLWYYFYNJ-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|