C12H21FN2 — CID 138552900
4-[(2S)-1-(2-fluoroethyl)pyrrolidin-2-yl]-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 138552900) has the molecular formula C12H21FN2 and a molecular weight of 212.31 g/mol. Its IUPAC name is 4-[(2S)-1-(2-fluoroethyl)pyrrolidin-2-yl]-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-[(2S)-1-(2-fluoroethyl)pyrrolidin-2-yl]-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 138552900 |
| Molecular Formula | C12H21FN2 |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 4-[(2S)-1-(2-fluoroethyl)pyrrolidin-2-yl]-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CN1CC=C([C@@H]2CCCN2CCF)CC1 |
| InChI | InChI=1S/C12H21FN2/c1-14-8-4-11(5-9-14)12-3-2-7-15(12)10-6-13/h4,12H,2-3,5-10H2,1H3/t12-/m0/s1 |
| InChIKey | JIBPDNLJCPDFES-LBPRGKRZSA-N |
| XLogP | 1.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|