C17H22FN3 — CID 138553911
2-(1-bicyclo[1.1.1]pentanylmethyl)-7-fluoro-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 138553911) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(1-bicyclo[1.1.1]pentanylmethyl)-7-fluoro-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 2-(1-bicyclo[1.1.1]pentanylmethyl)-7-fluoro-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 138553911 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-(1-bicyclo[1.1.1]pentanylmethyl)-7-fluoro-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C/C=C\C(=C/C)C1CC(F)c2nc(CC34CC(C3)C4)nn21 |
| InChI | InChI=1S/C17H22FN3/c1-3-5-12(4-2)14-6-13(18)16-19-15(20-21(14)16)10-17-7-11(8-17)9-17/h3-5,11,13-14H,6-10H2,1-2H3/b5-3-,12-4+ |
| InChIKey | LQWOTOHVMBYGEM-BVEFSZSYSA-N |
| XLogP | 4.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|