C15H14IN3O3 — CID 138555553
7-iodo-5-[4-(2-methoxyethoxy)phenyl]-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 138555553) has the molecular formula C15H14IN3O3 and a molecular weight of 411.20 g/mol. Its IUPAC name is 7-iodo-5-[4-(2-methoxyethoxy)phenyl]-3H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-iodo-5-[4-(2-methoxyethoxy)phenyl]-3H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138555553 |
| Molecular Formula | C15H14IN3O3 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 7-iodo-5-[4-(2-methoxyethoxy)phenyl]-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | COCCOc1ccc(-n2cc(I)c3nc[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C15H14IN3O3/c1-21-6-7-22-11-4-2-10(3-5-11)19-8-12(16)13-14(19)15(20)18-9-17-13/h2-5,8-9H,6-7H2,1H3,(H,17,18,20) |
| InChIKey | YXNSILVADZCRFZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|