C21H25FN4O7PS+ — CID 138556348
[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-[(1-cyclobutyloxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium (PubChem CID 138556348) has the molecular formula C21H25FN4O7PS+ and a molecular weight of 527.49 g/mol. Its IUPAC name is [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-[(1-cyclobutyloxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium.
| Compound Name | [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-[(1-cyclobutyloxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
|---|---|
| PubChem CID | 138556348 |
| Molecular Formula | C21H25FN4O7PS+ |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | [(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-[(1-cyclobutyloxy-1-oxopropan-2-yl)-phenoxyamino]-oxophosphanium |
| SMILES | CC(C(=O)OC1CCC1)N(Oc1ccccc1)[P+](=O)OC[C@@H]1O[C@H](n2cc(F)c(N)nc2=O)CS1 |
| InChI | InChI=1S/C21H24FN4O7PS/c1-13(20(27)31-14-8-5-9-14)26(33-15-6-3-2-4-7-15)34(29)30-11-18-32-17(12-35-18)25-10-16(22)19(23)24-21(25)28/h2-4,6-7,10,13-14,17-18H,5,8-9,11-12H2,1H3,(H-,23,24,28)/p+1/t13?,17-,18+/m0/s1 |
| InChIKey | XYZHETYFESITDC-UGGKNOJYSA-O |
| XLogP | 3.01 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|