C26H37FN5O6PS — CID 171781860
butyl (2S)-2-[[[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-(4-phenylpiperidin-1-yl)phosphoryl]amino]propanoate (PubChem CID 171781860) has the molecular formula C26H37FN5O6PS and a molecular weight of 597.65 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-(4-phenylpiperidin-1-yl)phosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-(4-phenylpiperidin-1-yl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171781860 |
| Molecular Formula | C26H37FN5O6PS |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | butyl (2S)-2-[[[(2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methoxy-(4-phenylpiperidin-1-yl)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(OC[C@@H]1O[C@H](n2cc(F)c(N)nc2=O)CS1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H37FN5O6PS/c1-3-4-14-36-25(33)18(2)30-39(35,31-12-10-20(11-13-31)19-8-6-5-7-9-19)37-16-23-38-22(17-40-23)32-15-21(27)24(28)29-26(32)34/h5-9,15,18,20,22-23H,3-4,10-14,16-17H2,1-2H3,(H,30,35)(H2,28,29,34)/t18-,22-,23+,39?/m0/s1 |
| InChIKey | POEDVSCSIWUCTM-GGQBJFBLSA-N |
| XLogP | 3.88 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|