C17H16F2N4O3 — CID 138556700
4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-ethyl-4-[(Z)-hydroxyiminomethyl]pyrazol-1-yl]-2,5-difluorophenol (PubChem CID 138556700) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is 4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-ethyl-4-[(Z)-hydroxyiminomethyl]pyrazol-1-yl]-2,5-difluorophenol.
| Compound Name | 4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-ethyl-4-[(Z)-hydroxyiminomethyl]pyrazol-1-yl]-2,5-difluorophenol |
|---|---|
| PubChem CID | 138556700 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 4-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-ethyl-4-[(Z)-hydroxyiminomethyl]pyrazol-1-yl]-2,5-difluorophenol |
| SMILES | CCc1nn(-c2cc(F)c(O)cc2F)c(-c2c(C)noc2C)c1/C=N\O |
| InChI | InChI=1S/C17H16F2N4O3/c1-4-13-10(7-20-25)17(16-8(2)22-26-9(16)3)23(21-13)14-5-12(19)15(24)6-11(14)18/h5-7,24-25H,4H2,1-3H3/b20-7- |
| InChIKey | MJULUWHMEDHTGS-SCDVKCJHSA-N |
| XLogP | 3.50 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|