C16H13F2N3O3S — CID 56839326
4-(2,5-difluoro-4-hydroxyphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxythiophene-2-carboximidamide (PubChem CID 56839326) has the molecular formula C16H13F2N3O3S and a molecular weight of 365.36 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-hydroxyphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxythiophene-2-carboximidamide.
| Compound Name | 4-(2,5-difluoro-4-hydroxyphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxythiophene-2-carboximidamide |
|---|---|
| PubChem CID | 56839326 |
| Molecular Formula | C16H13F2N3O3S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 4-(2,5-difluoro-4-hydroxyphenyl)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxythiophene-2-carboximidamide |
| SMILES | Cc1noc(C)c1-c1c(-c2cc(F)c(O)cc2F)csc1/C(N)=N/O |
| InChI | InChI=1S/C16H13F2N3O3S/c1-6-13(7(2)24-21-6)14-9(5-25-15(14)16(19)20-23)8-3-11(18)12(22)4-10(8)17/h3-5,22-23H,1-2H3,(H2,19,20) |
| InChIKey | RLNXHLNXTBUQCX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|