C13H8F4O — CID 153104252
4-(2,6-difluoro-4-methylphenyl)-2,5-difluorophenol (PubChem CID 153104252) has the molecular formula C13H8F4O and a molecular weight of 256.20 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-methylphenyl)-2,5-difluorophenol.
| Compound Name | 4-(2,6-difluoro-4-methylphenyl)-2,5-difluorophenol |
|---|---|
| PubChem CID | 153104252 |
| Molecular Formula | C13H8F4O |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-(2,6-difluoro-4-methylphenyl)-2,5-difluorophenol |
| SMILES | Cc1cc(F)c(-c2cc(F)c(O)cc2F)c(F)c1 |
| InChI | InChI=1S/C13H8F4O/c1-6-2-10(16)13(11(17)3-6)7-4-9(15)12(18)5-8(7)14/h2-5,18H,1H3 |
| InChIKey | VRRDBSKQUFOASA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |