C20H21FN4O3 — CID 77141480
2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-fluoro-4-hydroxyphenyl)-N'-hydroxy-4,5,6,7-tetrahydroindole-1-carboximidamide (PubChem CID 77141480) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-fluoro-4-hydroxyphenyl)-N'-hydroxy-4,5,6,7-tetrahydroindole-1-carboximidamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-fluoro-4-hydroxyphenyl)-N'-hydroxy-4,5,6,7-tetrahydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 77141480 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-(2-fluoro-4-hydroxyphenyl)-N'-hydroxy-4,5,6,7-tetrahydroindole-1-carboximidamide |
| SMILES | Cc1noc(C)c1-c1c(-c2ccc(O)cc2F)c2c(n1C(N)=NO)CCCC2 |
| InChI | InChI=1S/C20H21FN4O3/c1-10-17(11(2)28-24-10)19-18(13-8-7-12(26)9-15(13)21)14-5-3-4-6-16(14)25(19)20(22)23-27/h7-9,26-27H,3-6H2,1-2H3,(H2,22,23) |
| InChIKey | PEDMJEXLCXAUSA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|