C20H22N4O3 — CID 137060548
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-3-(4-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1-carboximidamide (PubChem CID 137060548) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-3-(4-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1-carboximidamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-3-(4-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1-carboximidamide |
|---|---|
| PubChem CID | 137060548 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-3-(4-hydroxyphenyl)-4,5,6,7-tetrahydroisoindole-1-carboximidamide |
| SMILES | Cc1noc(C)c1-n1c(C(N)=NO)c2c(c1-c1ccc(O)cc1)CCCC2 |
| InChI | InChI=1S/C20H22N4O3/c1-11-17(12(2)27-23-11)24-18(13-7-9-14(25)10-8-13)15-5-3-4-6-16(15)19(24)20(21)22-26/h7-10,25-26H,3-6H2,1-2H3,(H2,21,22) |
| InChIKey | BLEBQLYRYDHAFR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|