C11H11BFNO3 — CID 140959618
[4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-fluorophenyl]boronic acid (PubChem CID 140959618) has the molecular formula C11H11BFNO3 and a molecular weight of 235.02 g/mol. Its IUPAC name is [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-fluorophenyl]boronic acid.
| Compound Name | [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 140959618 |
| Molecular Formula | C11H11BFNO3 |
| Molecular Weight | 235.02 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | [4-(3,5-dimethyl-1,2-oxazol-4-yl)-2-fluorophenyl]boronic acid |
| SMILES | Cc1noc(C)c1-c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C11H11BFNO3/c1-6-11(7(2)17-14-6)8-3-4-9(12(15)16)10(13)5-8/h3-5,15-16H,1-2H3 |
| InChIKey | XSSDPBBOUWLEES-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.02 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|