C17H20BF2NO3 — CID 70655136
4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 70655136) has the molecular formula C17H20BF2NO3 and a molecular weight of 335.16 g/mol. Its IUPAC name is 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 70655136 |
| Molecular Formula | C17H20BF2NO3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cc(F)c(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C17H20BF2NO3/c1-9-14(10(2)22-21-9)11-7-12(19)15(13(20)8-11)18-23-16(3,4)17(5,6)24-18/h7-8H,1-6H3 |
| InChIKey | WHOGNSCPOGRKFN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|