C19H19BF2N2O7 — CID 169406601
2-amino-4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406601) has the molecular formula C19H19BF2N2O7 and a molecular weight of 436.18 g/mol. Its IUPAC name is 2-amino-4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406601 |
| Molecular Formula | C19H19BF2N2O7 |
| Molecular Weight | 436.18 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-amino-4-[3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1(C)OB(c2c(F)cc(-c3c(C(=O)O)c(N)[nH]c(=O)c3C(=O)O)cc2F)OC1(C)C |
| InChI | InChI=1S/C19H19BF2N2O7/c1-18(2)19(3,4)31-20(30-18)13-8(21)5-7(6-9(13)22)10-11(16(26)27)14(23)24-15(25)12(10)17(28)29/h5-6H,1-4H3,(H,26,27)(H,28,29)(H3,23,24,25) |
| InChIKey | UGZILLVYCACHON-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|