C21H25BN2O9 — CID 169406241
2-amino-4-[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid (PubChem CID 169406241) has the molecular formula C21H25BN2O9 and a molecular weight of 460.25 g/mol. Its IUPAC name is 2-amino-4-[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 2-amino-4-[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 169406241 |
| Molecular Formula | C21H25BN2O9 |
| Molecular Weight | 460.25 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-amino-4-[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-oxo-1H-pyridine-3,5-dicarboxylic acid |
| SMILES | COc1cc(OC)c(-c2c(C(=O)O)c(N)[nH]c(=O)c2C(=O)O)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H25BN2O9/c1-20(2)21(3,4)33-22(32-20)10-7-9(30-5)8-11(31-6)12(10)13-14(18(26)27)16(23)24-17(25)15(13)19(28)29/h7-8H,1-6H3,(H,26,27)(H,28,29)(H3,23,24,25) |
| InChIKey | RAUYLRZYDFQFTP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 170.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|