C15H12BF2NO3 — CID 88878447
4-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-3,5-difluorophenyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 88878447) has the molecular formula C15H12BF2NO3 and a molecular weight of 303.07 g/mol. Its IUPAC name is 4-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-3,5-difluorophenyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-3,5-difluorophenyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 88878447 |
| Molecular Formula | C15H12BF2NO3 |
| Molecular Weight | 303.07 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-3,5-difluorophenyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | C=C1OB(c2c(F)cc(-c3c(C)noc3C)cc2F)OC1=C |
| InChI | InChI=1S/C15H12BF2NO3/c1-7-14(10(4)22-19-7)11-5-12(17)15(13(18)6-11)16-20-8(2)9(3)21-16/h5-6H,2-3H2,1,4H3 |
| InChIKey | MGDURFCDMBUQAP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|