C19H22N4O4S — CID 138559540
5-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-methylpyrazol-1-yl)benzenesulfonamide (PubChem CID 138559540) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-methylpyrazol-1-yl)benzenesulfonamide.
| Compound Name | 5-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-methylpyrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 138559540 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 5-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-methylpyrazol-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(N)ccc2-n2cc(C)cn2)c(OC)c1 |
| InChI | InChI=1S/C19H22N4O4S/c1-13-10-21-23(12-13)17-7-5-15(20)8-19(17)28(24,25)22-11-14-4-6-16(26-2)9-18(14)27-3/h4-10,12,22H,11,20H2,1-3H3 |
| InChIKey | RYXHCZBQFHKSOS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|