C18H19FN4O4S — CID 175751617
3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-fluoropyrazol-1-yl)benzenesulfonamide (PubChem CID 175751617) has the molecular formula C18H19FN4O4S and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-fluoropyrazol-1-yl)benzenesulfonamide.
| Compound Name | 3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-fluoropyrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 175751617 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-amino-N-[(2,4-dimethoxyphenyl)methyl]-2-(4-fluoropyrazol-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cccc(N)c2-n2cc(F)cn2)c(OC)c1 |
| InChI | InChI=1S/C18H19FN4O4S/c1-26-14-7-6-12(16(8-14)27-2)9-22-28(24,25)17-5-3-4-15(20)18(17)23-11-13(19)10-21-23/h3-8,10-11,22H,9,20H2,1-2H3 |
| InChIKey | FDHJQJQAJANBIH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|