C23H23FN2O5S — CID 175751838
2-[3-[2-[(2,4-dimethoxyphenyl)methylsulfamoyl]phenyl]-2-fluorophenyl]acetamide (PubChem CID 175751838) has the molecular formula C23H23FN2O5S and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[3-[2-[(2,4-dimethoxyphenyl)methylsulfamoyl]phenyl]-2-fluorophenyl]acetamide.
| Compound Name | 2-[3-[2-[(2,4-dimethoxyphenyl)methylsulfamoyl]phenyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 175751838 |
| Molecular Formula | C23H23FN2O5S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[3-[2-[(2,4-dimethoxyphenyl)methylsulfamoyl]phenyl]-2-fluorophenyl]acetamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccccc2-c2cccc(CC(N)=O)c2F)c(OC)c1 |
| InChI | InChI=1S/C23H23FN2O5S/c1-30-17-11-10-16(20(13-17)31-2)14-26-32(28,29)21-9-4-3-7-18(21)19-8-5-6-15(23(19)24)12-22(25)27/h3-11,13,26H,12,14H2,1-2H3,(H2,25,27) |
| InChIKey | IJYUMJAHGABAAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |