C21H24N4O4S — CID 138559512
5-amino-2-(3-cyclopropylpyrazol-1-yl)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 138559512) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 5-amino-2-(3-cyclopropylpyrazol-1-yl)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-2-(3-cyclopropylpyrazol-1-yl)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 138559512 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 5-amino-2-(3-cyclopropylpyrazol-1-yl)-N-[(2,4-dimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(N)ccc2-n2ccc(C3CC3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H24N4O4S/c1-28-17-7-5-15(20(12-17)29-2)13-23-30(26,27)21-11-16(22)6-8-19(21)25-10-9-18(24-25)14-3-4-14/h5-12,14,23H,3-4,13,22H2,1-2H3 |
| InChIKey | GGKWFVYDWKXIJB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|