C9H8I2O — CID 138563808
4,4-diiodo-2,3-dihydrochromene (PubChem CID 138563808) has the molecular formula C9H8I2O and a molecular weight of 385.97 g/mol. Its IUPAC name is 4,4-diiodo-2,3-dihydrochromene.
| Compound Name | 4,4-diiodo-2,3-dihydrochromene |
|---|---|
| PubChem CID | 138563808 |
| Molecular Formula | C9H8I2O |
| Molecular Weight | 385.97 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 4,4-diiodo-2,3-dihydrochromene |
| SMILES | IC1(I)CCOc2ccccc21 |
| InChI | InChI=1S/C9H8I2O/c10-9(11)5-6-12-8-4-2-1-3-7(8)9/h1-4H,5-6H2 |
| InChIKey | ITQQTUZQRFJBID-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|