C15H17NO3 — CID 79129238
4-(4-hydroxyoxan-4-yl)-2,3-dihydrochromene-4-carbonitrile (PubChem CID 79129238) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-(4-hydroxyoxan-4-yl)-2,3-dihydrochromene-4-carbonitrile.
| Compound Name | 4-(4-hydroxyoxan-4-yl)-2,3-dihydrochromene-4-carbonitrile |
|---|---|
| PubChem CID | 79129238 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-(4-hydroxyoxan-4-yl)-2,3-dihydrochromene-4-carbonitrile |
| SMILES | N#CC1(C2(O)CCOCC2)CCOc2ccccc21 |
| InChI | InChI=1S/C15H17NO3/c16-11-14(15(17)6-8-18-9-7-15)5-10-19-13-4-2-1-3-12(13)14/h1-4,17H,5-10H2 |
| InChIKey | QCDPBRFMAJOKDQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |