C25H49NS — CID 138564200
(2,6-dimethyl-3-methylidenecyclooctyl)-[(7-methyl-2-propylnonyl)amino]methanethiol (PubChem CID 138564200) has the molecular formula C25H49NS and a molecular weight of 395.74 g/mol. Its IUPAC name is (2,6-dimethyl-3-methylidenecyclooctyl)-[(7-methyl-2-propylnonyl)amino]methanethiol.
| Compound Name | (2,6-dimethyl-3-methylidenecyclooctyl)-[(7-methyl-2-propylnonyl)amino]methanethiol |
|---|---|
| PubChem CID | 138564200 |
| Molecular Formula | C25H49NS |
| Molecular Weight | 395.74 g/mol |
| Exact Mass | 395.36 |
| IUPAC Name | (2,6-dimethyl-3-methylidenecyclooctyl)-[(7-methyl-2-propylnonyl)amino]methanethiol |
| SMILES | C=C1CCC(C)CCC(C(S)NCC(CCC)CCCCC(C)CC)C1C |
| InChI | InChI=1S/C25H49NS/c1-7-11-23(13-10-9-12-19(3)8-2)18-26-25(27)24-17-15-20(4)14-16-21(5)22(24)6/h19-20,22-27H,5,7-18H2,1-4,6H3 |
| InChIKey | ACEDDPHLJDAHOD-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.74 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|