C26H53NS — CID 170279854
3-ethyl-5,6-dimethyl-13-[methyl(6-methylhept-6-enyl)amino]tridecane-4-thiol (PubChem CID 170279854) has the molecular formula C26H53NS and a molecular weight of 411.78 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-13-[methyl(6-methylhept-6-enyl)amino]tridecane-4-thiol.
| Compound Name | 3-ethyl-5,6-dimethyl-13-[methyl(6-methylhept-6-enyl)amino]tridecane-4-thiol |
|---|---|
| PubChem CID | 170279854 |
| Molecular Formula | C26H53NS |
| Molecular Weight | 411.78 g/mol |
| Exact Mass | 411.39 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-13-[methyl(6-methylhept-6-enyl)amino]tridecane-4-thiol |
| SMILES | C=C(C)CCCCCN(C)CCCCCCCC(C)C(C)C(S)C(CC)CC |
| InChI | InChI=1S/C26H53NS/c1-8-25(9-2)26(28)24(6)23(5)19-15-11-10-12-16-20-27(7)21-17-13-14-18-22(3)4/h23-26,28H,3,8-21H2,1-2,4-7H3 |
| InChIKey | OPCKJZKDTWEXJE-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.78 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|