C23H35N5 — CID 138566017
(2S)-2-[[2-(4-octylphenyl)-4H-imidazol-5-yl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 138566017) has the molecular formula C23H35N5 and a molecular weight of 381.57 g/mol. Its IUPAC name is (2S)-2-[[2-(4-octylphenyl)-4H-imidazol-5-yl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[[2-(4-octylphenyl)-4H-imidazol-5-yl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 138566017 |
| Molecular Formula | C23H35N5 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (2S)-2-[[2-(4-octylphenyl)-4H-imidazol-5-yl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H]1CC1=NC(c2ccc(CCCCCCCC)cc2)=NC1 |
| InChI | InChI=1S/C23H35N5/c1-2-3-4-5-6-7-9-18-11-13-19(14-12-18)22-26-17-20(27-22)16-21-10-8-15-28(21)23(24)25/h11-14,21H,2-10,15-17H2,1H3,(H3,24,25)/t21-/m0/s1 |
| InChIKey | VUSKRACPMDOKKR-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|