C12H27NO2 — CID 138567096
2-amino-3-(2,5,5-trimethylhexan-3-yloxy)propan-1-ol (PubChem CID 138567096) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is 2-amino-3-(2,5,5-trimethylhexan-3-yloxy)propan-1-ol.
| Compound Name | 2-amino-3-(2,5,5-trimethylhexan-3-yloxy)propan-1-ol |
|---|---|
| PubChem CID | 138567096 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | 2-amino-3-(2,5,5-trimethylhexan-3-yloxy)propan-1-ol |
| SMILES | CC(C)C(CC(C)(C)C)OCC(N)CO |
| InChI | InChI=1S/C12H27NO2/c1-9(2)11(6-12(3,4)5)15-8-10(13)7-14/h9-11,14H,6-8,13H2,1-5H3 |
| InChIKey | QQXUSOMENMSBQC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |