C25H38O3 — CID 138568262
ethyl 4-(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoate (PubChem CID 138568262) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is ethyl 4-(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoate.
| Compound Name | ethyl 4-(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoate |
|---|---|
| PubChem CID | 138568262 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | ethyl 4-(10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)butanoate |
| SMILES | CCOC(=O)CCCC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H38O3/c1-4-28-23(27)7-5-6-17-9-11-21-20-10-8-18-16-19(26)12-14-25(18,3)22(20)13-15-24(17,21)2/h16-17,20-22H,4-15H2,1-3H3 |
| InChIKey | VLDOOCTYRGZHEZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |