C27H44O4 — CID 57179161
(8S,9R,10R,13R,14S)-17-[4-(1-ethoxyethoxy)-4-hydroxybutyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57179161) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (8S,9R,10R,13R,14S)-17-[4-(1-ethoxyethoxy)-4-hydroxybutyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,13R,14S)-17-[4-(1-ethoxyethoxy)-4-hydroxybutyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57179161 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (8S,9R,10R,13R,14S)-17-[4-(1-ethoxyethoxy)-4-hydroxybutyl]-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCOC(C)OC(O)CCCC1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O4/c1-5-30-18(2)31-25(29)8-6-7-19-10-12-23-22-11-9-20-17-21(28)13-15-27(20,4)24(22)14-16-26(19,23)3/h17-19,22-25,29H,5-16H2,1-4H3/t18?,19?,22-,23-,24+,25?,26+,27-/m0/s1 |
| InChIKey | NTFPLBUYDGYBDX-NMIQZMAZSA-N |
| XLogP | 6.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|