C26H40O4 — CID 57055246
[4-[(8S,9R,10R,13R,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxybutyl] propanoate (PubChem CID 57055246) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [4-[(8S,9R,10R,13R,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxybutyl] propanoate.
| Compound Name | [4-[(8S,9R,10R,13R,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxybutyl] propanoate |
|---|---|
| PubChem CID | 57055246 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [4-[(8S,9R,10R,13R,14S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-1-hydroxybutyl] propanoate |
| SMILES | CCC(=O)OC(O)CCCC1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40O4/c1-4-23(28)30-24(29)7-5-6-17-9-11-21-20-10-8-18-16-19(27)12-14-26(18,3)22(20)13-15-25(17,21)2/h16-17,20-22,24,29H,4-15H2,1-3H3/t17?,20-,21-,22+,24?,25+,26-/m0/s1 |
| InChIKey | JZTUHQJNBQQRCM-NCGQLPBRSA-N |
| XLogP | 5.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|