C24H26N4O3S — CID 138569545
5-[(E)-1-[[1-(cyclopropylcarbamothioyl)-2,3-dihydroindol-5-yl]oxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide (PubChem CID 138569545) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 5-[(E)-1-[[1-(cyclopropylcarbamothioyl)-2,3-dihydroindol-5-yl]oxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide.
| Compound Name | 5-[(E)-1-[[1-(cyclopropylcarbamothioyl)-2,3-dihydroindol-5-yl]oxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide |
|---|---|
| PubChem CID | 138569545 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 5-[(E)-1-[[1-(cyclopropylcarbamothioyl)-2,3-dihydroindol-5-yl]oxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide |
| SMILES | C=Nc1cc(OC)c(C(N)=O)cc1/C(=C\C)Oc1ccc2c(c1)CCN2C(=S)NC1CC1 |
| InChI | InChI=1S/C24H26N4O3S/c1-4-21(17-12-18(23(25)29)22(30-3)13-19(17)26-2)31-16-7-8-20-14(11-16)9-10-28(20)24(32)27-15-5-6-15/h4,7-8,11-13,15H,2,5-6,9-10H2,1,3H3,(H2,25,29)(H,27,32)/b21-4+ |
| InChIKey | NAKHVDYZNCNGOF-IPBDZQFASA-N |
| XLogP | 3.97 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|