About 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine
4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine (PubChem CID 138571735) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine.
Analyze 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine?
The IUPAC name of 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine (CID 138571735) is 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine.
What is the SMILES notation for 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine?
The canonical SMILES for 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine is C=C(C)C1=CCN(C)CCO1.
What is the InChIKey of 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine?
The InChIKey is JSWLBOZOQNTINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-8(2)9-4-5-10(3)6-7-11-9/h4H,1,5-7H2,2-3H3.
What are the key properties of 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine?
4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine has a molecular weight of 153.22 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-prop-1-en-2-yl-3,5-dihydro-2H-1,4-oxazepine is sourced from PubChem (CID 138571735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).