C15H26FNO2 — CID 142114831
N-ethyl-N-[2-[(3E,5Z)-3-fluoro-5-methylhepta-1,3,5-trien-2-yl]oxyethyl]-2-methoxyethanamine (PubChem CID 142114831) has the molecular formula C15H26FNO2 and a molecular weight of 271.38 g/mol. Its IUPAC name is N-ethyl-N-[2-[(3E,5Z)-3-fluoro-5-methylhepta-1,3,5-trien-2-yl]oxyethyl]-2-methoxyethanamine.
| Compound Name | N-ethyl-N-[2-[(3E,5Z)-3-fluoro-5-methylhepta-1,3,5-trien-2-yl]oxyethyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 142114831 |
| Molecular Formula | C15H26FNO2 |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-ethyl-N-[2-[(3E,5Z)-3-fluoro-5-methylhepta-1,3,5-trien-2-yl]oxyethyl]-2-methoxyethanamine |
| SMILES | C=C(OCCN(CC)CCOC)/C(F)=C\C(C)=C/C |
| InChI | InChI=1S/C15H26FNO2/c1-6-13(3)12-15(16)14(4)19-11-9-17(7-2)8-10-18-5/h6,12H,4,7-11H2,1-3,5H3/b13-6-,15-12+ |
| InChIKey | RHEWHMYEBODSRO-ZTAWCMRGSA-N |
| XLogP | 3.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|