C14H26FNO — CID 144808749
N-ethyl-N-[2-[(2E,4E)-4-fluorohepta-2,4-dien-3-yl]oxyethyl]propan-1-amine (PubChem CID 144808749) has the molecular formula C14H26FNO and a molecular weight of 243.37 g/mol. Its IUPAC name is N-ethyl-N-[2-[(2E,4E)-4-fluorohepta-2,4-dien-3-yl]oxyethyl]propan-1-amine.
| Compound Name | N-ethyl-N-[2-[(2E,4E)-4-fluorohepta-2,4-dien-3-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 144808749 |
| Molecular Formula | C14H26FNO |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-ethyl-N-[2-[(2E,4E)-4-fluorohepta-2,4-dien-3-yl]oxyethyl]propan-1-amine |
| SMILES | C/C=C(OCCN(CC)CCC)\C(F)=C/CC |
| InChI | InChI=1S/C14H26FNO/c1-5-9-13(15)14(7-3)17-12-11-16(8-4)10-6-2/h7,9H,5-6,8,10-12H2,1-4H3/b13-9+,14-7+ |
| InChIKey | HEXOOSIJSUQYEL-BTLVJFLNSA-N |
| XLogP | 3.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|