C13H23NO — CID 142506472
N,N-dimethyl-2-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-3-yl]oxyethanamine (PubChem CID 142506472) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-3-yl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 142506472 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | N,N-dimethyl-2-[(3E)-6-methyl-5-methylidenehepta-1,3-dien-3-yl]oxyethanamine |
| SMILES | C=C/C(=C\C(=C)C(C)C)OCCN(C)C |
| InChI | InChI=1S/C13H23NO/c1-7-13(10-12(4)11(2)3)15-9-8-14(5)6/h7,10-11H,1,4,8-9H2,2-3,5-6H3/b13-10+ |
| InChIKey | QTVAZGVLCCIGIT-JLHYYAGUSA-N |
| XLogP | 2.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|