C62H66N2 — CID 138572784
4,10-dicyclohexyl-1-N,1-N,7-N,7-N-tetrakis(3,5-dimethylphenyl)chrysene-1,7-diamine (PubChem CID 138572784) has the molecular formula C62H66N2 and a molecular weight of 839.22 g/mol. Its IUPAC name is 4,10-dicyclohexyl-1-N,1-N,7-N,7-N-tetrakis(3,5-dimethylphenyl)chrysene-1,7-diamine.
| Compound Name | 4,10-dicyclohexyl-1-N,1-N,7-N,7-N-tetrakis(3,5-dimethylphenyl)chrysene-1,7-diamine |
|---|---|
| PubChem CID | 138572784 |
| Molecular Formula | C62H66N2 |
| Molecular Weight | 839.22 g/mol |
| Exact Mass | 838.52 |
| IUPAC Name | 4,10-dicyclohexyl-1-N,1-N,7-N,7-N-tetrakis(3,5-dimethylphenyl)chrysene-1,7-diamine |
| SMILES | Cc1cc(C)cc(N(c2cc(C)cc(C)c2)c2ccc(C3CCCCC3)c3c2ccc2c3ccc3c(N(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)ccc(C4CCCCC4)c32)c1 |
| InChI | InChI=1S/C62H66N2/c1-39-27-40(2)32-49(31-39)63(50-33-41(3)28-42(4)34-50)59-25-23-53(47-15-11-9-12-16-47)61-55-20-22-58-60(26-24-54(48-17-13-10-14-18-48)62(58)56(55)19-21-57(59)61)64(51-35-43(5)29-44(6)36-51)52-37-45(7)30-46(8)38-52/h19-38,47-48H,9-18H2,1-8H3 |
| InChIKey | IPIJTCIICBYDNC-UHFFFAOYSA-N |
| XLogP | 18.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.22 |
| LogP ≤ 5 | 18.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|