C23H30F2N4O2 — CID 138578594
tert-butyl (3aS)-5-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluoroanilino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 138578594) has the molecular formula C23H30F2N4O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl (3aS)-5-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluoroanilino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS)-5-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluoroanilino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 138578594 |
| Molecular Formula | C23H30F2N4O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl (3aS)-5-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluoroanilino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | Cc1nn(C)cc1-c1ccc(NC2CC3CN(C(=O)OC(C)(C)C)C[C@H]3C2)c(F)c1F |
| InChI | InChI=1S/C23H30F2N4O2/c1-13-18(12-28(5)27-13)17-6-7-19(21(25)20(17)24)26-16-8-14-10-29(11-15(14)9-16)22(30)31-23(2,3)4/h6-7,12,14-16,26H,8-11H2,1-5H3/t14-,15?,16?/m1/s1 |
| InChIKey | DKQSNDVDRNYQLV-QQFBHYJXSA-N |
| XLogP | 4.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |