C35H46N4O3 — CID 138583229
tert-butyl 3-[[4-[3-(dibenzylamino)propyl]-N-formylanilino]methyl]-4-methylpiperazine-1-carboxylate (PubChem CID 138583229) has the molecular formula C35H46N4O3 and a molecular weight of 570.78 g/mol. Its IUPAC name is tert-butyl 3-[[4-[3-(dibenzylamino)propyl]-N-formylanilino]methyl]-4-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-[3-(dibenzylamino)propyl]-N-formylanilino]methyl]-4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 138583229 |
| Molecular Formula | C35H46N4O3 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | tert-butyl 3-[[4-[3-(dibenzylamino)propyl]-N-formylanilino]methyl]-4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)CC1CN(C=O)c1ccc(CCCN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H46N4O3/c1-35(2,3)42-34(41)38-23-22-36(4)33(26-38)27-39(28-40)32-19-17-29(18-20-32)16-11-21-37(24-30-12-7-5-8-13-30)25-31-14-9-6-10-15-31/h5-10,12-15,17-20,28,33H,11,16,21-27H2,1-4H3 |
| InChIKey | IPDVYUFAZPEPBD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|