C26H20F2N6O3 — CID 138583735
N-[3-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]prop-2-enamide (PubChem CID 138583735) has the molecular formula C26H20F2N6O3 and a molecular weight of 502.48 g/mol. Its IUPAC name is N-[3-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138583735 |
| Molecular Formula | C26H20F2N6O3 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[3-[[7-(2,6-difluoro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Nc2ncc3cc(-c4c(F)c(OC)cc(OC)c4F)c4nccn4c3n2)c1 |
| InChI | InChI=1S/C26H20F2N6O3/c1-4-20(35)31-15-6-5-7-16(11-15)32-26-30-13-14-10-17(25-29-8-9-34(25)24(14)33-26)21-22(27)18(36-2)12-19(37-3)23(21)28/h4-13H,1H2,2-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | WEPBXKCUSLUUEA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|