About 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid
2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid (PubChem CID 138584666) has the molecular formula C9H9FN2O4
and a molecular weight of 228.18 g/mol. Its IUPAC name is 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid |
| PubChem CID | 138584666 |
| Molecular Formula | C9H9FN2O4 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(F)c(/C(N)=N/O)c1 |
| InChI | InChI=1S/C9H9FN2O4/c1-16-4-2-5(8(11)12-15)7(10)6(3-4)9(13)14/h2-3,15H,1H3,(H2,11,12)(H,13,14) |
| InChIKey | AWWUJQSJYKPKPK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid?
The IUPAC name of 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid (CID 138584666) is 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid.
What is the SMILES notation for 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid?
The canonical SMILES for 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid is COc1cc(C(=O)O)c(F)c(/C(N)=N/O)c1.
What is the InChIKey of 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid?
The InChIKey is AWWUJQSJYKPKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O4/c1-16-4-2-5(8(11)12-15)7(10)6(3-4)9(13)14/h2-3,15H,1H3,(H2,11,12)(H,13,14).
What are the key properties of 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid?
2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid has a molecular weight of 228.18 g/mol, XLogP of 0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-[(Z)-N'-hydroxycarbamimidoyl]-5-methoxybenzoic acid is sourced from PubChem (CID 138584666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).