C9H4BrF3N2O4S — CID 138585577
(6-bromo-4-oxo-3H-phthalazin-1-yl) trifluoromethanesulfonate (PubChem CID 138585577) has the molecular formula C9H4BrF3N2O4S and a molecular weight of 373.11 g/mol. Its IUPAC name is (6-bromo-4-oxo-3H-phthalazin-1-yl) trifluoromethanesulfonate.
| Compound Name | (6-bromo-4-oxo-3H-phthalazin-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 138585577 |
| Molecular Formula | C9H4BrF3N2O4S |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 371.90 |
| IUPAC Name | (6-bromo-4-oxo-3H-phthalazin-1-yl) trifluoromethanesulfonate |
| SMILES | O=c1[nH]nc(OS(=O)(=O)C(F)(F)F)c2ccc(Br)cc12 |
| InChI | InChI=1S/C9H4BrF3N2O4S/c10-4-1-2-5-6(3-4)7(16)14-15-8(5)19-20(17,18)9(11,12)13/h1-3H,(H,14,16) |
| InChIKey | MOCQRMIOGRPAGR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|