C12H11FN2S — CID 138586240
(4S,6S)-4-fluoro-6-phenyl-1,4,5,6-tetrahydropyrrolo[1,2-b]pyrazole-2-thione (PubChem CID 138586240) has the molecular formula C12H11FN2S and a molecular weight of 234.30 g/mol. Its IUPAC name is (4S,6S)-4-fluoro-6-phenyl-1,4,5,6-tetrahydropyrrolo[1,2-b]pyrazole-2-thione.
| Compound Name | (4S,6S)-4-fluoro-6-phenyl-1,4,5,6-tetrahydropyrrolo[1,2-b]pyrazole-2-thione |
|---|---|
| PubChem CID | 138586240 |
| Molecular Formula | C12H11FN2S |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (4S,6S)-4-fluoro-6-phenyl-1,4,5,6-tetrahydropyrrolo[1,2-b]pyrazole-2-thione |
| SMILES | F[C@H]1C[C@@H](c2ccccc2)n2[nH]c(=S)cc21 |
| InChI | InChI=1S/C12H11FN2S/c13-9-6-10(8-4-2-1-3-5-8)15-11(9)7-12(16)14-15/h1-5,7,9-10H,6H2,(H,14,16)/t9-,10-/m0/s1 |
| InChIKey | SKWVHPVAYSEONV-UWVGGRQHSA-N |
| XLogP | 3.55 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|