C11H9F2N3S — CID 142577338
7-fluoro-5-(2-fluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione (PubChem CID 142577338) has the molecular formula C11H9F2N3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 7-fluoro-5-(2-fluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione.
| Compound Name | 7-fluoro-5-(2-fluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
|---|---|
| PubChem CID | 142577338 |
| Molecular Formula | C11H9F2N3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 7-fluoro-5-(2-fluorophenyl)-3,5,6,7-tetrahydropyrrolo[1,2-b][1,2,4]triazole-2-thione |
| SMILES | Fc1ccccc1C1CC(F)c2nc(=S)[nH]n21 |
| InChI | InChI=1S/C11H9F2N3S/c12-7-4-2-1-3-6(7)9-5-8(13)10-14-11(17)15-16(9)10/h1-4,8-9H,5H2,(H,15,17) |
| InChIKey | ZEVHGJHWHVALGC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|