C13H16FN3O2 — CID 138596011
(1S,2S,5R)-2-[(2-amino-4-fluoroanilino)methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid (PubChem CID 138596011) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is (1S,2S,5R)-2-[(2-amino-4-fluoroanilino)methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid.
| Compound Name | (1S,2S,5R)-2-[(2-amino-4-fluoroanilino)methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|---|
| PubChem CID | 138596011 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (1S,2S,5R)-2-[(2-amino-4-fluoroanilino)methyl]-3-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| SMILES | Nc1cc(F)ccc1NC[C@@H]1[C@H]2C[C@H]2CN1C(=O)O |
| InChI | InChI=1S/C13H16FN3O2/c14-8-1-2-11(10(15)4-8)16-5-12-9-3-7(9)6-17(12)13(18)19/h1-2,4,7,9,12,16H,3,5-6,15H2,(H,18,19)/t7-,9-,12+/m0/s1 |
| InChIKey | RDGGTQFAGUOSQB-QOSJWCAFSA-N |
| XLogP | 1.82 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|